EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | N[C@H](C=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H11NO2/c10-8(6-11)5-7-1-3-9(12)4-2-7/h1-4,6,8,12H,5,10H2/t8-/m0/s1 |
| InChIKey | DXGAIOIQACHYRK-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosinal (CHEBI:46209) is a amino aldehyde (CHEBI:22492) |
| L-tyrosinal (CHEBI:46209) is a phenols (CHEBI:33853) |
| L-tyrosinal (CHEBI:46209) is a primary amino compound (CHEBI:50994) |
| L-tyrosinal (CHEBI:46209) is conjugate base of L-tyrosinal(1+) (CHEBI:141668) |
| Incoming Relation(s) |
| L-tyrosine (CHEBI:17895) has functional parent L-tyrosinal (CHEBI:46209) |
| L-tyrosinal(1+) (CHEBI:141668) is conjugate acid of L-tyrosinal (CHEBI:46209) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(4-hydroxyphenyl)propanal |
| Synonyms | Source |
|---|---|
| TYROSINAL | PDBeChem |
| (2S)-2-amino-3-(p-hydroxyphenyl)propanal | ChEBI |
| L-tyr aldehyde | ChEBI |
| Citations |
|---|