EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46151 - N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid
| Formula | C20H22N2O4 |
| Net Charge | 0 |
| Average Mass | 354.406 |
| Monoisotopic Mass | 354.15796 |
| SMILES | CN(CCCCC(=O)O)c1ccc(/C=C/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-21(15-3-2-4-20(23)24)18-11-7-16(8-12-18)5-6-17-9-13-19(14-10-17)22(25)26/h5-14H,2-4,15H2,1H3,(H,23,24)/b6-5+ |
| InChIKey | QLLZAVDYYAQESE-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid (CHEBI:46151) has parent hydride trans-stilbene (CHEBI:36007) |
| N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid (CHEBI:46151) has role epitope (CHEBI:53000) |
| N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid (CHEBI:46151) is a C-nitro compound (CHEBI:35716) |
| N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid (CHEBI:46151) is a monocarboxylic acid (CHEBI:25384) |
| N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid (CHEBI:46151) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 5-(methyl{4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl}amino)pentanoic acid |
| Synonym | Source |
|---|---|
| 5-(methyl{4-[(E)-2-(4-nitrophenyl)vinyl]phenyl}amino)pentanoic acid | ChEBI |
| Citations |
|---|