EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COC(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
| InChIKey | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dimethyl phthalate (CHEBI:4609) is a diester (CHEBI:51307) |
| Dimethyl phthalate (CHEBI:4609) is a methyl ester (CHEBI:25248) |
| Dimethyl phthalate (CHEBI:4609) is a phthalate ester (CHEBI:35484) |
| Synonyms | Source |
|---|---|
| dimethyl phthalate | DrugCentral |
| Dimethyl phthalate | KEGG COMPOUND |