EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N3 |
| Net Charge | +1 |
| Average Mass | 204.297 |
| Monoisotopic Mass | 204.14952 |
| SMILES | Nc1ccc(CNC2=[NH+]CCCC2)cc1 |
| InChI | InChI=1S/C12H17N3/c13-11-6-4-10(5-7-11)9-15-12-3-1-2-8-14-12/h4-7H,1-3,8-9,13H2,(H,14,15)/p+1 |
| InChIKey | FWTCHDHYLQERRE-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[(4-aminobenzyl)amino]-2,3,4,5-tetrahydropyridinium (CHEBI:46087) has role epitope (CHEBI:53000) |
| 6-[(4-aminobenzyl)amino]-2,3,4,5-tetrahydropyridinium (CHEBI:46087) is a carboxamidinium ion (CHEBI:77718) |
| IUPAC Name |
|---|
| 6-[(4-aminobenzyl)amino]-2,3,4,5-tetrahydropyridinium |
| Synonyms | Source |
|---|---|
| 2-(4-AMINOBENZYLAMINO)-3,4,5,6-TETRAHYDROPYRIDINIUM | PDBeChem |
| 6-[(4-aminobenzyl)amino]-2,3,4,5-tetrahydropyridinium | PDBeChem |
| Citations |
|---|