EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O2 |
| Net Charge | 0 |
| Average Mass | 340.507 |
| Monoisotopic Mass | 340.24023 |
| SMILES | [H][C@@]12C[C@H](C)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@@]1(O)C#CC |
| InChI | InChI=1S/C23H32O2/c1-5-9-23(25)12-8-19-17-13-15(2)20-14-16(24)6-10-21(20,3)18(17)7-11-22(19,23)4/h14-15,17-19,25H,6-8,10-13H2,1-4H3/t15-,17+,18-,19-,21+,22-,23-/m0/s1 |
| InChIKey | LVHOURKCKUYIGK-RGUJTQARSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dimethisterone (CHEBI:4606) has role androgen (CHEBI:50113) |
| Dimethisterone (CHEBI:4606) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| dimethiderome | DrugCentral |
| dimethisteron | DrugCentral |
| Dimethisterone | KEGG COMPOUND |
| Dimethisterone anhydrous | KEGG COMPOUND |