EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11Cl2NO4 |
| Net Charge | 0 |
| Average Mass | 328.151 |
| Monoisotopic Mass | 327.00651 |
| SMILES | CN(C(=O)C(Cl)Cl)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C14H11Cl2NO4/c1-17(13(18)12(15)16)9-4-6-10(7-5-9)21-14(19)11-3-2-8-20-11/h2-8,12H,1H3 |
| InChIKey | BDYYDXJSHYEDGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diloxanide furoate (CHEBI:4601) has role antiamoebic agent (CHEBI:171664) |
| diloxanide furoate (CHEBI:4601) has role prodrug (CHEBI:50266) |
| diloxanide furoate (CHEBI:4601) is a carboxylic ester (CHEBI:33308) |
| diloxanide furoate (CHEBI:4601) is a furans (CHEBI:24129) |
| diloxanide furoate (CHEBI:4601) is a organochlorine compound (CHEBI:36683) |
| diloxanide furoate (CHEBI:4601) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 4-[(dichloroacetyl)(methyl)amino]phenyl furan-2-carboxylate |
| Synonyms | Source |
|---|---|
| 8073 CB | ChemIDplus |
| CB 8073 | ChemIDplus |
| diloxanide furoate | KEGG COMPOUND |
| diloxanid furoate | DrugCentral |
| entamide furoate | DrugCentral |
| Brand Names | Source |
|---|---|
| Amebiazol | ChemIDplus |
| Dichlofurazol | DrugCentral |
| Diclofurazol | ChemIDplus |
| Furamide | ChemIDplus |
| Furentomin | ChemIDplus |
| Histomibal | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 18400 | ChemSpider |
| 896 | DrugCentral |
| C07637 | KEGG COMPOUND |
| D02480 | KEGG DRUG |
| DB14638 | DrugBank |
| Diloxanide | Wikipedia |
| HMDB0015684 | HMDB |
| LSM-2223 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:3736-81-0 | ChemIDplus |
| Citations |
|---|