EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C57H110O6 |
| Net Charge | 0 |
| Average Mass | 891.501 |
| Monoisotopic Mass | 890.83024 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C57H110O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h54H,4-53H2,1-3H3 |
| InChIKey | DCXXMTOCNZCJGO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (23475189) |
| Roles Classification |
|---|
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tristearoylglycerol (CHEBI:45956) has functional parent octadecanoic acid (CHEBI:28842) |
| tristearoylglycerol (CHEBI:45956) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| tristearoylglycerol (CHEBI:45956) has role plant metabolite (CHEBI:76924) |
| tristearoylglycerol (CHEBI:45956) is a triacylglycerol 54:0 (CHEBI:138347) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl trioctadecanoate |
| Synonyms | Source |
|---|---|
| 2,3-di(octadecanoyloxy)propyl octadecanoate | ChEBI |
| TG(18:0/18:0/18:0) | LIPID MAPS |
| glyceryl tristearate | ChEBI |
| stearin | ChEBI |
| tristearin | ChEBI |
| Trioctadecanoin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| trioctadecanoylglycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| TGL | PDBeChem |
| LMGL03010002 | LIPID MAPS |
| HMDB0005393 | HMDB |
| Stearin | Wikipedia |
| CN102229860 | Patent |
| Citations |
|---|