EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CCC/C2=C\C=C1/C[C@@H](O)CC[C@@H]1C |
| InChI | InChI=1S/C28H46O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-22,25-27,29H,7-8,11,14-18H2,1-6H3/b10-9+,23-12+,24-13+/t20-,21-,22+,25-,26+,27-,28+/m0/s1 |
| InChIKey | ILYCWAKSDCYMBB-OPCMSESCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrotachysterol (CHEBI:4591) has role bone density conservation agent (CHEBI:50646) |
| dihydrotachysterol (CHEBI:4591) is a hydroxy seco-steroid (CHEBI:36853) |
| dihydrotachysterol (CHEBI:4591) is a seco-ergostane (CHEBI:36819) |
| dihydrotachysterol (CHEBI:4591) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (3S,5E,7E,10S,22E)-9,10-secoergosta-5,7,22-trien-3-ol |
| INNs | Source |
|---|---|
| dihydrotachysterol | ChemIDplus |
| dihidrotaquisterol | ChemIDplus |
| dihydrotachysterolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Dihydrotachysterol | KEGG COMPOUND |
| AT 10 | ChemIDplus |
| Anti-tetany substance 10 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06957 | KEGG COMPOUND |
| D00299 | KEGG DRUG |
| DB01070 | DrugBank |
| LMST03010056 | LIPID MAPS |
| Dihydrotachysterol | Wikipedia |
| 2841 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2062504 | Reaxys |
| CAS:67-96-9 | KEGG COMPOUND |
| Citations |
|---|