EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | CC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C6H11NO4/c1-3(8)5(6(10)11)7-4(2)9/h3,5,8H,1-2H3,(H,7,9)(H,10,11)/t3-,5+/m1/s1 |
| InChIKey | PEDXUVCGOLSNLQ-WUJLRWPWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-threonine (CHEBI:45826) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-threonine (CHEBI:45826) is a L-threonine derivative (CHEBI:84189) |
| N-acetyl-L-threonine (CHEBI:45826) is conjugate acid of N-acetyl-L-threoninate (CHEBI:133549) |
| Incoming Relation(s) |
| N-acetyl-L-threoninate (CHEBI:133549) is conjugate base of N-acetyl-L-threonine (CHEBI:45826) |
| N-acetyl-L-threonyl residue (CHEBI:133375) is substituent group from N-acetyl-L-threonine (CHEBI:45826) |
| IUPAC Name |
|---|
| N-acetyl-L-threonine |
| Synonym | Source |
|---|---|
| N-acetylthreonine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| THC | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2357672 | Reaxys |
| CAS:17093-74-2 | ChemIDplus |
| Citations |
|---|