EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | Oc1ccc(CCc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H14O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h3-9,15-17H,1-2H2 |
| InChIKey | HITJFUSPLYBJPE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | - | DOI (10.1021/np50031a011) |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroresveratrol (CHEBI:4582) has role plant metabolite (CHEBI:76924) |
| dihydroresveratrol (CHEBI:4582) has role xenobiotic metabolite (CHEBI:76206) |
| dihydroresveratrol (CHEBI:4582) is a stilbenol (CHEBI:36027) |
| Incoming Relation(s) |
| dihydroresveratrol glucuronide (CHEBI:84047) has functional parent dihydroresveratrol (CHEBI:4582) |
| dihydroresveratrol glucuronide sulfate (CHEBI:84049) has functional parent dihydroresveratrol (CHEBI:4582) |
| dihydroresveratrol sulfate (CHEBI:84045) has functional parent dihydroresveratrol (CHEBI:4582) |
| IUPAC Name |
|---|
| 5-[2-(4-hydroxyphenyl)ethyl]benzene-1,3-diol |
| Synonym | Source |
|---|---|
| 3,4',5-trihydroxybibenzyl | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00002879 | KNApSAcK |
| C10255 | KEGG COMPOUND |
| Dihydro-resveratrol | Wikipedia |
| LMPK13090035 | LIPID MAPS |
| RE2 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1880985 | Reaxys |
| CAS:58436-28-5 | KEGG COMPOUND |
| CAS:58436-28-5 | ChemIDplus |
| Citations |
|---|