EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O2 |
| Net Charge | 0 |
| Average Mass | 214.264 |
| Monoisotopic Mass | 214.09938 |
| SMILES | Oc1cc(O)cc(CCc2ccccc2)c1 |
| InChI | InChI=1S/C14H14O2/c15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h1-5,8-10,15-16H,6-7H2 |
| InChIKey | LDBYHULIXFIJAZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oroxylum indicum (ncbitaxon:83951) | seed (BTO:0001226) | PubMed (23672042) | |
| Pinus sylvestris (ncbitaxon:3349) | - | PubMed (1536925) | |
| Stemona collinsae (ncbitaxon:492015) | - | PubMed (15679323) | |
| Stemona tuberosa (ncbitaxon:167572) | - | PubMed (15679323) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydropinosylvin (CHEBI:4579) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| dihydropinosylvin (CHEBI:4579) has role plant metabolite (CHEBI:76924) |
| dihydropinosylvin (CHEBI:4579) is a diphenylethane (CHEBI:51571) |
| dihydropinosylvin (CHEBI:4579) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 5-(2-phenylethyl)benzene-1,3-diol |
| Synonym | Source |
|---|---|
| 5-(2-phenylethyl)resorcinol | ChEBI |
| UniProt Name | Source |
|---|---|
| dihydropinosylvin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002878 | KNApSAcK |
| C10254 | KEGG COMPOUND |
| CPD-6963 | MetaCyc |
| LMPK13090034 | LIPID MAPS |
| WO03049713 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2050839 | Reaxys |
| CAS:14531-52-3 | KEGG COMPOUND |
| Citations |
|---|