EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44N2O9 |
| Net Charge | 0 |
| Average Mass | 600.709 |
| Monoisotopic Mass | 600.30468 |
| SMILES | [H][C@]1([C@H](C)/C=C(C)/C=C/C(O)=C2\C(=O)N([C@@H]3CC[C@H](O)[C@H](C)O3)[C@@]([H])([C@H](C)C(=O)NC)C2=O)O[C@@]2(C)O[C@H](C=C[C@@]23CO3)[C@@H]1C |
| InChI | InChI=1S/C32H44N2O9/c1-16(14-17(2)28-18(3)23-12-13-32(15-40-32)31(6,42-23)43-28)8-9-22(36)25-27(37)26(19(4)29(38)33-7)34(30(25)39)24-11-10-21(35)20(5)41-24/h8-9,12-14,17-21,23-24,26,28,35-36H,10-11,15H2,1-7H3,(H,33,38)/b9-8+,16-14+,25-22+/t17-,18+,19+,20+,21+,23-,24+,26+,28-,31-,32-/m1/s1 |
| InChIKey | KVTPRMVXYZKLIG-NCAOFHFGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lydicus (ncbitaxon:47763) | - | DOI (10.1021/ja107190w) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptolydigin (CHEBI:45773) has role antimicrobial agent (CHEBI:33281) |
| streptolydigin (CHEBI:45773) has role bacterial metabolite (CHEBI:76969) |
| streptolydigin (CHEBI:45773) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| streptolydigin (CHEBI:45773) is a N-glycosyl compound (CHEBI:21731) |
| streptolydigin (CHEBI:45773) is a bridged compound (CHEBI:35990) |
| streptolydigin (CHEBI:45773) is a cyclic ketal (CHEBI:59779) |
| streptolydigin (CHEBI:45773) is a enol (CHEBI:33823) |
| streptolydigin (CHEBI:45773) is a monocarboxylic acid amide (CHEBI:29347) |
| streptolydigin (CHEBI:45773) is a organic heterobicyclic compound (CHEBI:27171) |
| streptolydigin (CHEBI:45773) is a pyrrolidinone (CHEBI:38275) |
| streptolydigin (CHEBI:45773) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (2S)-2-{(2S,4E)-4-{(2E,4E,6R)-6-[(1R,2R,5R,6S,7R)-1,6-dimethylspiro[8,9-dioxabicyclo[3.3.1]non-3-ene-2,2'-oxiran]-7-yl]-1-hydroxy-4-methylhepta-2,4-dien-1-ylidene}-1-[(2S,5S,6S)-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]-3,5-dioxopyrrolidin-2-yl}-N-methylpropanamide |
| Synonyms | Source |
|---|---|
| Antibiotic D-45 | ChemIDplus |
| NSC 3360 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB04785 | DrugBank |
| STD | PDBeChem |
| Streptolydigin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9977901 | Reaxys |
| CAS:7229-50-7 | ChemIDplus |
| Citations |
|---|