EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:45728 - sparsomycin
| Formula | C13H19N3O5S2 |
| Net Charge | 0 |
| Average Mass | 361.445 |
| Monoisotopic Mass | 361.07661 |
| SMILES | CSC[S@](=O)C[C@H](CO)NC(=O)/C=C/c1c(C)nc(=O)nc1=O |
| InChI | InChI=1S/C13H19N3O5S2/c1-8-10(12(19)16-13(20)14-8)3-4-11(18)15-9(5-17)6-23(21)7-22-2/h3-4,9,17H,5-7H2,1-2H3,(H,15,18)(H2,14,16,19,20)/b4-3+/t9-,23+/m0/s1 |
| InChIKey | XKLZIVIOZDNKEQ-CLQLPEFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sparsogenes (ncbitaxon:67365) | - | PubMed (29111481) | Strain: ATCC 25498 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sparsomycin (CHEBI:45728) has role antimicrobial agent (CHEBI:33281) |
| sparsomycin (CHEBI:45728) has role antineoplastic agent (CHEBI:35610) |
| sparsomycin (CHEBI:45728) has role bacterial metabolite (CHEBI:76969) |
| sparsomycin (CHEBI:45728) has role protein synthesis inhibitor (CHEBI:48001) |
| sparsomycin (CHEBI:45728) is a enamide (CHEBI:51751) |
| sparsomycin (CHEBI:45728) is a methyl sulfide (CHEBI:86315) |
| sparsomycin (CHEBI:45728) is a primary alcohol (CHEBI:15734) |
| sparsomycin (CHEBI:45728) is a pyrimidone (CHEBI:38337) |
| sparsomycin (CHEBI:45728) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| (2E)-N-[(2S)-1-hydroxy-3-{(R)-[(methylsulfanyl)methyl]sulfinyl}propan-2-yl]-3-(6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)prop-2-enamide |
| INNs | Source |
|---|---|
| esparsomicina | WHO MedNet |
| sparsomycin | WHO MedNet |
| sparsomycine | WHO MedNet |
| sparsomycinum | WHO MedNet |
| Synonym | Source |
|---|---|
| (+)-sparsomycin | ChEBI |
| Citations |
|---|