EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19NO6 |
| Net Charge | 0 |
| Average Mass | 393.395 |
| Monoisotopic Mass | 393.12124 |
| SMILES | COc1cc2c(c3c1-c1cc(OC)c4cc5c(cc4c1N(C)C3)OCO5)OCO2 |
| InChI | InChI=1S/C22H19NO6/c1-23-8-14-20(18(25-3)7-19-22(14)29-10-28-19)13-6-15(24-2)11-4-16-17(27-9-26-16)5-12(11)21(13)23/h4-7H,8-10H2,1-3H3 |
| InChIKey | RTVFIUBAXAZKSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydromacarpine (CHEBI:18029) has functional parent dihydrosanguinarine (CHEBI:17209) |
| dihydromacarpine (CHEBI:18029) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| 5,7-dimethoxy-13-methyl-13,14-dihydro-2H,10H-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridine |
| Synonyms | Source |
|---|---|
| Dihydromacarpine | KEGG COMPOUND |
| 13,14-Dihydro-5,7-dimethoxy-13-methyl-[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine | KEGG COMPOUND |
| 13,14-dihydro-5,7-dimethoxy-13-methyl-[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine | ChEBI |
| UniProt Name | Source |
|---|---|
| dihydromacarpine | UniProt |
| Citations |
|---|