EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(O)[C@@H](O)C[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A1d22h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3-5,7-10H,1-2H2,(H,11,12)/t3-,4-,5+/m0/s1 |
| InChIKey | YGMNHEPVTNXLLS-VAYJURFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (534687) | Detected in the uremic serum. | |
| cell suspension culture (BTO:0000221) | PubMed (24894601) | Detected in human colon carcinoma cell line (HCT 8). | |
| Phoenix dactylifera (ncbitaxon:42345) | - | PubMed (31533283) | |
| Pinus pinaster (ncbitaxon:71647) | - | DOI (10.1007/s00226-010-0356-0) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-deoxy-D-arabino-hexonic acid (CHEBI:45626) has role human metabolite (CHEBI:77746) |
| 3-deoxy-D-arabino-hexonic acid (CHEBI:45626) has role plant metabolite (CHEBI:76924) |
| 3-deoxy-D-arabino-hexonic acid (CHEBI:45626) is a hexonic acid (CHEBI:33752) |
| IUPAC Name |
|---|
| 3-deoxy-D-arabino-hexonic acid |
| Synonyms | Source |
|---|---|
| (2S,4S,5R)-2,4,5,6-tetrahydroxyhexanoic acid | IUPAC |
| 3-deoxyarabino-hexonic acid | ChemIDplus |
| 3-deoxy-arabino-hexonic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB03303 | DrugBank |
| FDB021969 | FooDB |
| HMDB0000346 | HMDB |
| SSH | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:29625-79-4 | ChemIDplus |
| Citations |
|---|