EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O |
| Net Charge | 0 |
| Average Mass | 122.167 |
| Monoisotopic Mass | 122.07316 |
| SMILES | C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/t7-/m1/s1 |
| InChIKey | WAPNOHKVXSQRPX-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Triatoma brasiliensis (ncbitaxon:65344) | gland (BTO:0000522) | PubMed (21486009) | metasternal glands |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-1-phenylethanol (CHEBI:45616) has role animal metabolite (CHEBI:75767) |
| (R)-1-phenylethanol (CHEBI:45616) is a 1-phenylethanol (CHEBI:669) |
| (R)-1-phenylethanol (CHEBI:45616) is enantiomer of (S)-1-phenylethanol (CHEBI:16346) |
| Incoming Relation(s) |
| (S)-1-phenylethanol (CHEBI:16346) is enantiomer of (R)-1-phenylethanol (CHEBI:45616) |
| IUPAC Name |
|---|
| (1R)-1-phenylethanol |
| Synonyms | Source |
|---|---|
| (1R)-1-PHENYLETHANOL | PDBeChem |
| (R)-α-methylbenzenemethanol | NIST Chemistry WebBook |
| (R)-α-methylbenzyl alcohol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (R)-1-phenylethanol | UniProt |
| Citations |
|---|