EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | O=C(NO)c1ccccc1O |
| InChI | InChI=1S/C7H7NO3/c9-6-4-2-1-3-5(6)7(10)8-11/h1-4,9,11H,(H,8,10) |
| InChIKey | HBROZNQEVUILML-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.5 (urease) inhibitor EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the activity of urease (EC 3.5.1.5), reducing hydrolysis. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. EC 1.11.2.2 (myeloperoxidase) inhibitor An EC 1.11.2.* (oxidoreductase with H2O2 as acceptor, incorporating 1 O atom into product) inhibitor that interferes with the action of myeloperoxidase (EC 1.11.2.2). antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salicylhydroxamic acid (CHEBI:45615) has role antibacterial drug (CHEBI:36047) |
| salicylhydroxamic acid (CHEBI:45615) has role EC 1.11.2.2 (myeloperoxidase) inhibitor (CHEBI:79093) |
| salicylhydroxamic acid (CHEBI:45615) has role EC 3.5.1.5 (urease) inhibitor (CHEBI:50635) |
| salicylhydroxamic acid (CHEBI:45615) has role trypanocidal drug (CHEBI:36335) |
| salicylhydroxamic acid (CHEBI:45615) is a hydroxamic acid (CHEBI:24650) |
| salicylhydroxamic acid (CHEBI:45615) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N,2-dihydroxybenzamide |
| Synonyms | Source |
|---|---|
| 2-Hydroxybenzhydroxamic acid | ChemIDplus |
| 2-Hydroxybenzohydroxamic acid | ChemIDplus |
| o-Hydroxybenzohydroxamic acid | ChemIDplus |
| Salicylohydroximic acid | ChemIDplus |
| SHAM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11343 | KEGG COMPOUND |
| CN101519365 | Patent |
| CPD-6543 | MetaCyc |
| DB03819 | DrugBank |
| Salicylhydroxamic_acid | Wikipedia |
| SHA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1210520 | Reaxys |
| CAS:89-73-6 | KEGG COMPOUND |
| CAS:89-73-6 | ChemIDplus |
| Citations |
|---|