EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17789 - dihydrochelirubine
| Formula | C21H17NO5 |
| Net Charge | 0 |
| Average Mass | 363.369 |
| Monoisotopic Mass | 363.11067 |
| SMILES | COc1cc2c(c3c1-c1ccc4cc5c(cc4c1N(C)C3)OCO5)OCO2 |
| InChI | InChI=1S/C21H17NO5/c1-22-8-14-19(17(23-2)7-18-21(14)27-10-26-18)12-4-3-11-5-15-16(25-9-24-15)6-13(11)20(12)22/h3-7H,8-10H2,1-2H3 |
| InChIKey | JPXUJRDPZQUCNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrochelirubine (CHEBI:17789) has functional parent dihydrosanguinarine (CHEBI:17209) |
| dihydrochelirubine (CHEBI:17789) has role metabolite (CHEBI:25212) |
| dihydrochelirubine (CHEBI:17789) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| 5-methoxy-13-methyl-13,14-dihydro-2H,10H-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridine |
| Synonyms | Source |
|---|---|
| Dihydrochelirubine | KEGG COMPOUND |
| 13,14-Dihydro-5-methoxy-13-methyl-[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| dihydrochelirubine | UniProt |
| Citations |
|---|