EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O7 |
| Net Charge | 0 |
| Average Mass | 400.427 |
| Monoisotopic Mass | 400.15220 |
| SMILES | COc1cc(C[C@H]2C(=O)OC[C@@H]2Cc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C22H24O7/c1-24-19-9-14(10-20(25-2)21(19)26-3)7-16-15(11-27-22(16)23)6-13-4-5-17-18(8-13)29-12-28-17/h4-5,8-10,15-16H,6-7,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | GMLDZDDTZKXJLU-JKSUJKDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anthriscus sylvestris (ncbitaxon:48027) | - | PubMed (12956064) | |
| Austrocedrus chilensis (ncbitaxon:103964) | - | PubMed (25420758) | |
| Chamaecyparis obtusa (ncbitaxon:13415) | - | PubMed (16540181) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroanhydropodorhizol (CHEBI:4553) has role plant metabolite (CHEBI:76924) |
| dihydroanhydropodorhizol (CHEBI:4553) is a benzodioxoles (CHEBI:38298) |
| dihydroanhydropodorhizol (CHEBI:4553) is a butan-4-olide (CHEBI:22950) |
| dihydroanhydropodorhizol (CHEBI:4553) is a lignan (CHEBI:25036) |
| dihydroanhydropodorhizol (CHEBI:4553) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| (3R,4R)-4-[(2H-1,3-benzodioxol-5-yl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one |
| Synonyms | Source |
|---|---|
| (-)-Deoxypodorhizone | KNApSAcK |
| Yatein | KNApSAcK |
| UniProt Name | Source |
|---|---|
| (−)-yatein | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4300660 | Reaxys |
| CAS:40456-50-6 | KEGG COMPOUND |
| CAS:40456-50-6 | ChemIDplus |
| CAS:40456-50-6 | NIST Chemistry WebBook |
| Citations |
|---|