EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O |
| Net Charge | 0 |
| Average Mass | 74.123 |
| Monoisotopic Mass | 74.07316 |
| SMILES | CC[C@H](C)O |
| InChI | InChI=1S/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | BTANRVKWQNVYAZ-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-butan-2-ol (CHEBI:45475) is a butan-2-ol (CHEBI:35687) |
| (2S)-butan-2-ol (CHEBI:45475) is enantiomer of (2R)-butan-2-ol (CHEBI:35686) |
| Incoming Relation(s) |
| (2R)-butan-2-ol (CHEBI:35686) is enantiomer of (2S)-butan-2-ol (CHEBI:45475) |
| IUPAC Name |
|---|
| (2S)-butan-2-ol |
| Synonyms | Source |
|---|---|
| (S)-butan-2-ol | ChemIDplus |
| (S)-2-butanol | NIST Chemistry WebBook |
| 2-BUTANOL | PDBeChem |
| (S)-(+)-2-butanol | ChEBI |