EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N4O2 |
| Net Charge | 0 |
| Average Mass | 330.432 |
| Monoisotopic Mass | 330.20558 |
| SMILES | C[C@@H](N[C@@H](NCC(O)O)Nc1ccc(CN)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H26N4O2/c1-13(15-5-3-2-4-6-15)21-18(20-12-17(23)24)22-16-9-7-14(11-19)8-10-16/h2-10,13,17-18,20-24H,11-12,19H2,1H3/t13-,18-/m1/s1 |
| InChIKey | LPSXGZAUAOMRNU-FZKQIMNGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(R)-{[4-(aminomethyl)phenyl]amino}{[(1R)-1-phenylethyl]amino}methyl]amino}ethane-1,1-diol (CHEBI:45412) has role epitope (CHEBI:53000) |
| 2-{[(R)-{[4-(aminomethyl)phenyl]amino}{[(1R)-1-phenylethyl]amino}methyl]amino}ethane-1,1-diol (CHEBI:45412) is a aldehyde hydrate (CHEBI:63733) |
| 2-{[(R)-{[4-(aminomethyl)phenyl]amino}{[(1R)-1-phenylethyl]amino}methyl]amino}ethane-1,1-diol (CHEBI:45412) is a tetramine (CHEBI:39166) |
| IUPAC Name |
|---|
| 2-{[(R)-[4-(aminomethyl)anilino]{[(1R)-1-phenylethyl]amino}methyl]amino}ethane-1,1-diol |
| Synonym | Source |
|---|---|
| 2-{[(R)-{[4-(aminomethyl)phenyl]amino}{[(1R)-1-phenylethyl]amino}methyl]amino}ethane-1,1-diol | ChEBI |
| Citations |
|---|