EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N4O7P2 |
| Net Charge | +1 |
| Average Mass | 419.291 |
| Monoisotopic Mass | 419.08800 |
| SMILES | Cc1ncc(C[n+]2cccc(CCOP(=O)(O)OP(=O)(O)O)c2C)c(N)n1 |
| InChI | InChI=1S/C14H20N4O7P2/c1-10-12(5-7-24-27(22,23)25-26(19,20)21)4-3-6-18(10)9-13-8-16-11(2)17-14(13)15/h3-4,6,8H,5,7,9H2,1-2H3,(H4-,15,16,17,19,20,21,22,23)/p+1 |
| InChIKey | ZHKSTKOYQKNDSJ-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrithiamine pyrophosphate (CHEBI:45395) has functional parent pyrithiamine (CHEBI:72290) |
| pyrithiamine pyrophosphate (CHEBI:45395) has role antimicrobial agent (CHEBI:33281) |
| pyrithiamine pyrophosphate (CHEBI:45395) is a pyridinium ion (CHEBI:50334) |
| IUPAC Name |
|---|
| 1-[(4-amino-2-methylpyrimidin-5-yl)methyl]-3-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-2-methylpyridinium |
| Synonym | Source |
|---|---|
| pyrithiamine diphosphate | ChEBI |
| Citations |
|---|