EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19F2N3O3 |
| Net Charge | 0 |
| Average Mass | 399.397 |
| Monoisotopic Mass | 399.13945 |
| SMILES | CN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H19F2N3O3/c1-24-6-8-25(9-7-24)19-11-18-15(10-17(19)23)20(27)16(21(28)29)12-26(18)14-4-2-13(22)3-5-14/h2-5,10-12H,6-9H2,1H3,(H,28,29) |
| InChIKey | NOCJXYPHIIZEHN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) | Inhibits topoisomerase II/DNA gyrase and topoisomerase IV |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difloxacin (CHEBI:4537) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| difloxacin (CHEBI:4537) has role antibacterial drug (CHEBI:36047) |
| difloxacin (CHEBI:4537) is a N-alkylpiperazine (CHEBI:46845) |
| difloxacin (CHEBI:4537) is a N-arylpiperazine (CHEBI:46848) |
| difloxacin (CHEBI:4537) is a fluoroquinolone antibiotic (CHEBI:87211) |
| difloxacin (CHEBI:4537) is a monocarboxylic acid (CHEBI:25384) |
| difloxacin (CHEBI:4537) is a monofluorobenzenes (CHEBI:83575) |
| difloxacin (CHEBI:4537) is a quinolone (CHEBI:23765) |
| difloxacin (CHEBI:4537) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| difloxacin | WHO MedNet |
| difloxacine | WHO MedNet |
| difloxacino | WHO MedNet |
| difloxacinum | WHO MedNet |
| Synonym | Source |
|---|---|
| 6-fluoro-1-(4-fluorophenyl)-7-(4-methyl-1-piperazinyl)-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5835542 | Reaxys |
| CAS:98106-17-3 | ChemIDplus |
| CAS:98106-17-3 | KEGG COMPOUND |
| Citations |
|---|