EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O10 |
| Net Charge | 0 |
| Average Mass | 464.467 |
| Monoisotopic Mass | 464.16825 |
| SMILES | COc1ccc([C@@H]2CCc3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)cc3O2)cc1OC |
| InChI | InChI=1S/C23H28O10/c1-29-15-5-3-11(7-18(15)30-2)14-6-4-13-16(31-14)8-12(25)9-17(13)32-23-22(28)21(27)20(26)19(10-24)33-23/h3,5,7-9,14,19-28H,4,6,10H2,1-2H3/t14-,19+,20+,21-,22+,23+/m0/s1 |
| InChIKey | ZNWIOJJMPZWSQO-YRDUZITASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hoppea dichotoma (ncbitaxon:84897) | - | DOI (10.1016/S0031-9422(00)84903-1) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diffutin (CHEBI:4536) has functional parent (2S)-flavan (CHEBI:36103) |
| diffutin (CHEBI:4536) has role plant metabolite (CHEBI:76924) |
| diffutin (CHEBI:4536) is a flavan glycoside (CHEBI:85938) |
| diffutin (CHEBI:4536) is a hydroxyflavan (CHEBI:72010) |
| diffutin (CHEBI:4536) is a methoxyflavan (CHEBI:72585) |
| diffutin (CHEBI:4536) is a monosaccharide derivative (CHEBI:63367) |
| diffutin (CHEBI:4536) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2S)-2-(3,4-dimethoxyphenyl)-7-hydroxy-3,4-dihydro-2H-1-benzopyran-5-yl β-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| C09636 | KEGG COMPOUND |
| C00008768 | KNApSAcK |
| LMPK12020267 | LIPID MAPS |
| Diffutin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6549261 | Reaxys |
| CAS:89289-91-8 | KEGG COMPOUND |