EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N6O |
| Net Charge | 0 |
| Average Mass | 354.458 |
| Monoisotopic Mass | 354.21681 |
| SMILES | CC[C@H](CO)Nc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C19H26N6O/c1-4-15(11-26)22-19-23-17(20-10-14-8-6-5-7-9-14)16-18(24-19)25(12-21-16)13(2)3/h5-9,12-13,15,26H,4,10-11H2,1-3H3,(H2,20,22,23,24)/t15-/m1/s1 |
| InChIKey | BTIHMVBBUGXLCJ-OAHLLOKOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seliciclib (CHEBI:45307) has role antineoplastic agent (CHEBI:35610) |
| seliciclib (CHEBI:45307) has role antiviral drug (CHEBI:36044) |
| seliciclib (CHEBI:45307) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| seliciclib (CHEBI:45307) is a 2,6-diaminopurines (CHEBI:38001) |
| IUPAC Name |
|---|
| (2R)-2-{[6-(benzylamino)-9-(propan-2-yl)-9H-purin-2-yl]amino}butan-1-ol |
| INN | Source |
|---|---|
| seliciclib | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(R)-(1-ethyl-2-hydroxyethylamino)-6-benzylamino-9-isopropylpurine | ChemIDplus |
| (2R)-2-{[6-(benzylamino)-9-(1-methylethyl)-9H-purin-2-yl]amino}butan-1-ol | PDBeChem |
| (2R)-2-((9-(1-methylethyl)-6-((phenylmethyl)amino)-9H-purin-2-yl)amino)-1-butanol | ChemIDplus |
| AL-39256 | ChEMBL |
| CYC-202 | ChEMBL |
| CYC202 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1001 | LINCS |
| RRC | PDBeChem |
| Seliciclib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7694281 | Reaxys |
| CAS:186692-46-6 | ChemIDplus |
| Citations |
|---|