EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21N3O |
| Net Charge | 0 |
| Average Mass | 199.298 |
| Monoisotopic Mass | 199.16846 |
| SMILES | CCN(CC)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C10H21N3O/c1-4-12(5-2)10(14)13-8-6-11(3)7-9-13/h4-9H2,1-3H3 |
| InChIKey | RCKMWOKWVGPNJF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antiparasitic agent A substance used to treat or prevent parasitic infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylcarbamazine (CHEBI:4527) has role anthelminthic drug (CHEBI:35443) |
| diethylcarbamazine (CHEBI:4527) has role antiinfective agent (CHEBI:35441) |
| diethylcarbamazine (CHEBI:4527) has role antiparasitic agent (CHEBI:35442) |
| diethylcarbamazine (CHEBI:4527) is a N-carbamoylpiperazine (CHEBI:46919) |
| diethylcarbamazine (CHEBI:4527) is a N-methylpiperazine (CHEBI:46920) |
| INN | Source |
|---|---|
| dietilcarbamazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| bitirazine | DrugCentral |
| Camin | ChEMBL |
| carbamazine | DrugCentral |
| carbilazine | DrugCentral |
| caricide | DrugCentral |
| Diethylcarbamazine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 873 | DrugCentral |
| C07968 | KEGG COMPOUND |
| D07825 | KEGG DRUG |
| HMDB0014849 | HMDB |
| LSM-3009 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:90-89-1 | KEGG COMPOUND |
| Citations |
|---|