EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O2 |
| Net Charge | 0 |
| Average Mass | 312.413 |
| Monoisotopic Mass | 312.18378 |
| SMILES | [H]c1c([H])c([H])c2c(c1[H])C([H])([H])C([H])([H])N1C(=O)C([H])([H])N(C(=O)C3([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C3([H])[H])C([H])([H])[C@@]21[H] |
| InChI | InChI=1S/C19H24N2O2/c22-18-13-20(19(23)15-7-2-1-3-8-15)12-17-16-9-5-4-6-14(16)10-11-21(17)18/h4-6,9,15,17H,1-3,7-8,10-13H2/t17-/m0/s1 |
| InChIKey | FSVJFNAIGNNGKK-KRWDZBQOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| praziquantel (CHEBI:45267) has role anthelminthic drug (CHEBI:35443) |
| praziquantel (CHEBI:45267) has role antiinfective agent (CHEBI:35441) |
| praziquantel (CHEBI:45267) is a monocarboxylic acid amide (CHEBI:29347) |
| praziquantel (CHEBI:45267) is a organic molecular entity (CHEBI:50860) |
| praziquantel (CHEBI:45267) is a pyrazinoisoquinoline (CHEBI:48338) |
| praziquantel (CHEBI:45267) is a racemate (CHEBI:60911) |
| INN | Source |
|---|---|
| prazicuantel | WHO MedNet |
| Synonyms | Source |
|---|---|
| (11bR)-2-(cyclohexylcarbonyl)-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one | PDBeChem |
| EMBAY 8440 | ChEMBL |
| EMBAY-8440 | ChEMBL |
| NSC-757285 | ChEMBL |
| Praziquantel | KEGG COMPOUND |
| PRAZIQUANTEL | PDBeChem |
| Brand Names | Source |
|---|---|
| Biltricide | ChEMBL |
| Cesol | ChEMBL |
| Cestocur | ChEMBL |
| Cisticid | ChEMBL |
| Praziquantel component of broadline | ChEMBL |
| Praziquantel component of profender | ChEMBL |
| Citations |
|---|