EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O2 |
| Net Charge | 0 |
| Average Mass | 168.196 |
| Monoisotopic Mass | 168.08988 |
| SMILES | Cc1ncc(CO)c(CN)c1O |
| InChI | InChI=1S/C8H12N2O2/c1-5-8(12)7(2-9)6(4-11)3-10-5/h3,11-12H,2,4,9H2,1H3 |
| InChIKey | NHZMQXZHNVQTQA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | |||
| blood (UBERON:0000178) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) | ||
| - | MetaboLights (MTBLS20) | From MetaboLights | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | MetaboLights (MTBLS376) | From MetaboLights Strain: C57bl/6 mouse (NCIT:C14424) | |
| Trypanosoma brucei (ncbitaxon:5691) | - | MetaboLights (MTBLS49) | From MetaboLights |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxamine (CHEBI:16410) has role Escherichia coli metabolite (CHEBI:76971) |
| pyridoxamine (CHEBI:16410) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| pyridoxamine (CHEBI:16410) has role human metabolite (CHEBI:77746) |
| pyridoxamine (CHEBI:16410) has role hypoglycemic agent (CHEBI:35526) |
| pyridoxamine (CHEBI:16410) has role iron chelator (CHEBI:38157) |
| pyridoxamine (CHEBI:16410) has role mouse metabolite (CHEBI:75771) |
| pyridoxamine (CHEBI:16410) has role nephroprotective agent (CHEBI:76595) |
| pyridoxamine (CHEBI:16410) has role plant metabolite (CHEBI:76924) |
| pyridoxamine (CHEBI:16410) is a aminoalkylpyridine (CHEBI:38198) |
| pyridoxamine (CHEBI:16410) is a hydroxymethylpyridine (CHEBI:38196) |
| pyridoxamine (CHEBI:16410) is a monohydroxypyridine (CHEBI:38182) |
| pyridoxamine (CHEBI:16410) is a vitamin B6 (CHEBI:27306) |
| pyridoxamine (CHEBI:16410) is conjugate base of pyridoxaminium(1+) (CHEBI:57761) |
| Incoming Relation(s) |
| pyridoxamine 5'-phosphate (CHEBI:18335) has functional parent pyridoxamine (CHEBI:16410) |
| pyridoxaminium(1+) (CHEBI:57761) is conjugate acid of pyridoxamine (CHEBI:16410) |
| IUPAC Name |
|---|
| 4-(aminomethyl)-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| Synonyms | Source |
|---|---|
| 4-(AMINOMETHYL)-5-(HYDROXYMETHYL)-2-METHYLPYRIDIN-3-OL | PDBeChem |
| PM | KEGG COMPOUND |
| Pyridoxamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1023 | ChemSpider |
| C00007504 | KNApSAcK |
| C00534 | KEGG COMPOUND |
| FDB021819 | FooDB |
| HMDB0001431 | HMDB |
| PXM | PDBeChem |
| Pyridoxamine | Wikipedia |
| PYRIDOXAMINE | MetaCyc |
| Citations |
|---|