EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2S2 |
| Net Charge | 0 |
| Average Mass | 208.348 |
| Monoisotopic Mass | 208.05917 |
| SMILES | O=C(O)CCCC[C@@H](S)CCS |
| InChI | InChI=1S/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10)/t7-/m1/s1 |
| InChIKey | IZFHEQBZOYJLPK-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-dihydrolipoic acid (CHEBI:45230) is a dihydrolipoic acid (CHEBI:18047) |
| (R)-dihydrolipoic acid (CHEBI:45230) is conjugate acid of (R)-dihydrolipoate (CHEBI:83093) |
| (R)-dihydrolipoic acid (CHEBI:45230) is enantiomer of (S)-dihydrolipoic acid (CHEBI:30318) |
| Incoming Relation(s) |
| (R)-dihydrolipoate (CHEBI:83093) is conjugate base of (R)-dihydrolipoic acid (CHEBI:45230) |
| (S)-dihydrolipoic acid (CHEBI:30318) is enantiomer of (R)-dihydrolipoic acid (CHEBI:45230) |
| (R)-dihydrolipoyl group (CHEBI:30319) is substituent group from (R)-dihydrolipoic acid (CHEBI:45230) |
| IUPAC Name |
|---|
| (6R)-6,8-disulfanyloctanoic acid |
| Synonyms | Source |
|---|---|
| (6R)-6,8-dihydrothioctic acid | ChEBI |
| (6R)-6,8-dimercaptooctanoic acid | IUPAC |
| (6R)-DHLA | ChEBI |
| DIHYDROLIPOIC ACID | PDBeChem |
| (R)-6,8-Dihydrothioctic acid | ChEBI |
| (R)-DHLA | ChEBI |
| Citations |
|---|