EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO4 |
| Net Charge | 0 |
| Average Mass | 267.325 |
| Monoisotopic Mass | 267.14706 |
| SMILES | CCOc1ccc(NC(=O)OC(C)C)cc1OCC |
| InChI | InChI=1S/C14H21NO4/c1-5-17-12-8-7-11(9-13(12)18-6-2)15-14(16)19-10(3)4/h7-10H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | LNJNFVJKDJYTEU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethofencarb (CHEBI:4520) has functional parent aniline (CHEBI:17296) |
| diethofencarb (CHEBI:4520) has role antifungal agrochemical (CHEBI:86328) |
| diethofencarb (CHEBI:4520) is a aromatic ether (CHEBI:35618) |
| diethofencarb (CHEBI:4520) is a carbamate ester (CHEBI:23003) |
| diethofencarb (CHEBI:4520) is a carbanilate fungicide (CHEBI:87066) |
| IUPAC Name |
|---|
| propan-2-yl (3,4-diethoxyphenyl)carbamate |
| Synonyms | Source |
|---|---|
| Isopropyl 3,4-diethoxycarbanilate | ChemIDplus |
| 1-Methylethyl (3,4-diethoxyphenyl)carbamate | ChemIDplus |
| isopropyl (3,4-diethoxyphenyl)carbamate | IUPAC |
| 1-methylethyl N-(3,4-diethoxyphenyl)carbamate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| C11077 | KEGG COMPOUND |
| diethofencarb | Alan Wood's Pesticides |
| 228 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8393454 | Reaxys |
| CAS:87130-20-9 | KEGG COMPOUND |
| CAS:87130-20-9 | ChemIDplus |
| CAS:87130-20-9 | NIST Chemistry WebBook |
| Citations |
|---|