EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O2 |
| Net Charge | 0 |
| Average Mass | 266.340 |
| Monoisotopic Mass | 266.13068 |
| SMILES | CC=C(C(=CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h3-12,19-20H,1-2H3 |
| InChIKey | NFDFQCUYFHCNBW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dienestrol (CHEBI:4518) has role xenoestrogen (CHEBI:76988) |
| dienestrol (CHEBI:4518) is a olefinic compound (CHEBI:78840) |
| dienestrol (CHEBI:4518) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4,4'-hexa-2,4-diene-3,4-diyldiphenol |
| INN | Source |
|---|---|
| dienestrol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Dienestrol | KEGG COMPOUND |
| Dehydrostilbestrol | KEGG COMPOUND |
| p,p'-(Diethylideneethylene)diphenol | NIST Chemistry WebBook |
| Di(p-oxyphenyl)-2,4-hexadiene | NIST Chemistry WebBook |
| 4,4'-Hydroxy-γ,δ-diphenyl-β,δ-hexadiene | NIST Chemistry WebBook |
| Citations |
|---|