EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O8 |
| Net Charge | 0 |
| Average Mass | 254.150 |
| Monoisotopic Mass | 254.00627 |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C10H6O8/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | CYIDZMCFTVVTJO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyromellitic acid (CHEBI:45165) is a benzoic acids (CHEBI:22723) |
| pyromellitic acid (CHEBI:45165) is a tetracarboxylic acid (CHEBI:35742) |
| IUPAC Name |
|---|
| benzene-1,2,4,5-tetracarboxylic acid |
| Citations |
|---|