EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO |
| Net Charge | 0 |
| Average Mass | 173.215 |
| Monoisotopic Mass | 173.08406 |
| SMILES | O=C1CCc2cccc3c2N1CC3 |
| InChI | InChI=1S/C11H11NO/c13-10-5-4-8-2-1-3-9-6-7-12(10)11(8)9/h1-3H,4-7H2 |
| InChIKey | XRJLAOUDSILTFT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyroquilon (CHEBI:45141) has role antifungal agrochemical (CHEBI:86328) |
| pyroquilon (CHEBI:45141) has role melanin synthesis inhibitor (CHEBI:64933) |
| pyroquilon (CHEBI:45141) is a pyrroloquinoline (CHEBI:50918) |
| pyroquilon (CHEBI:45141) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| 1,2,5,6-tetrahydro-4H-pyrrolo[3,2,1-ij]quinolin-4-one |
| Synonyms | Source |
|---|---|
| 1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one | Alan Wood's Pesticides |
| pyroquilone | ChEBI |
| Brand Names | Source |
|---|---|
| Coratop | ChemIDplus |
| Fongoren | ChemIDplus |
| Fongorene | ChemIDplus |
| Lilolidone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 575 | PPDB |
| C18487 | KEGG COMPOUND |
| HMDB0037113 | HMDB |
| PYQ | PDBeChem |
| pyroquilon | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1455831 | Reaxys |
| CAS:57369-32-1 | KEGG COMPOUND |
| CAS:57369-32-1 | Alan Wood's Pesticides |
| CAS:57369-32-1 | ChemIDplus |
| Citations |
|---|