EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12O6 |
| Net Charge | 0 |
| Average Mass | 336.299 |
| Monoisotopic Mass | 336.06339 |
| SMILES | O=c1oc2ccccc2c(O)c1Cc1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C19H12O6/c20-16-10-5-1-3-7-14(10)24-18(22)12(16)9-13-17(21)11-6-2-4-8-15(11)25-19(13)23/h1-8,20-21H,9H2 |
| InChIKey | DOBMPNYZJYQDGZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor An EC 1.6.5.* (oxidoreductase acting on NADH or NADPH with a quinone or similar as acceptor) inhibitor that interferes with the action of NAD(P)H dehydrogenase (quinone), EC 1.6.5.2. vitamin K antagonist A class of anticoagulants which act by inhibiting the action of vitamin K. |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicoumarol (CHEBI:4513) has role anticoagulant (CHEBI:50249) |
| dicoumarol (CHEBI:4513) has role EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor (CHEBI:50390) |
| dicoumarol (CHEBI:4513) has role Hsp90 inhibitor (CHEBI:63962) |
| dicoumarol (CHEBI:4513) has role vitamin K antagonist (CHEBI:55347) |
| dicoumarol (CHEBI:4513) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 3,3'-methanediylbis(4-hydroxy-2H-chromen-2-one) |
| INNs | Source |
|---|---|
| dicoumarol | ChEBI |
| dicoumarol | WHO MedNet |
| dicoumarolum | ChemIDplus |
| dicumarol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,3'-methylen-bis(4-hydroxy-cumarin) | ChemIDplus |
| 3,3'-methylenebis(4-hydroxy-1,2-benzopyrone) | ChemIDplus |
| 3,3'-methylenebis(4-hydroxy-2H-1-benzopyran-2-one) | ChemIDplus |
| 3,3'-methylenebis(4-hydroxycoumarin) | ChemIDplus |
| 3,3'-methylene-bis(4-hydroxycoumarine) | ChemIDplus |
| bis-3,3'-(4-hydroxycoumarinyl)methane | ChemIDplus |
| Citations |
|---|