EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9NO2 |
| Net Charge | 0 |
| Average Mass | 199.209 |
| Monoisotopic Mass | 199.06333 |
| SMILES | COc1c2ccccc2nc2occc12 |
| InChI | InChI=1S/C12H9NO2/c1-14-11-8-4-2-3-5-10(8)13-12-9(11)6-7-15-12/h2-7H,1H3 |
| InChIKey | WIONIXOBNMDJFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dictamnine (CHEBI:4512) is a alkaloid antibiotic (CHEBI:86322) |
| Dictamnine (CHEBI:4512) is a organic heterotricyclic compound (CHEBI:26979) |
| Dictamnine (CHEBI:4512) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Dictamnine (CHEBI:4512) is a oxacycle (CHEBI:38104) |
| Synonym | Source |
|---|---|
| Dictamnine | KEGG COMPOUND |