EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18FN3O4 |
| Net Charge | 0 |
| Average Mass | 371.368 |
| Monoisotopic Mass | 371.12813 |
| SMILES | Nc1c(C(=O)c2cccc(OC[C@@H](O)CO)c2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN3O4/c20-13-4-6-14(7-5-13)23-19(21)17(9-22-23)18(26)12-2-1-3-16(8-12)27-11-15(25)10-24/h1-9,15,24-25H,10-11,21H2/t15-/m0/s1 |
| InChIKey | IJDQETGUEUJVTB-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ro 320-1195 (CHEBI:45116) has functional parent 4-benzoylpyrazole (CHEBI:38980) |
| Ro 320-1195 (CHEBI:45116) has functional parent monofluorobenzene (CHEBI:5115) |
| Ro 320-1195 (CHEBI:45116) has role protein kinase inhibitor (CHEBI:37699) |
| Ro 320-1195 (CHEBI:45116) is a benzoylpyrazole (CHEBI:38318) |
| Ro 320-1195 (CHEBI:45116) is a organofluorine compound (CHEBI:37143) |
| Ro 320-1195 (CHEBI:45116) is a primary amino compound (CHEBI:50994) |
| Ro 320-1195 (CHEBI:45116) is a propane-1,2-diols (CHEBI:26284) |
| Incoming Relation(s) |
| linkable Ro 320-1195 analogue (CHEBI:39086) has functional parent Ro 320-1195 (CHEBI:45116) |
| IUPAC Name |
|---|
| [5-amino-1-(4-fluorophenyl)-1H-pyrazol-4-yl](3-{[(2S)-2,3-dihydroxypropyl]oxy}phenyl)methanone |
| Synonyms | Source |
|---|---|
| [5-AMINO-1-(4-FLUOROPHENYL)-1H-PYRAZOL-4-YL](3-{[(2R)-2,3-DIHYDROXYPROPYL]OXY}PHENYL)METHANONE | PDBeChem |
| Ro-320-1195 | ChEBI |