EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10INO2 |
| Net Charge | 0 |
| Average Mass | 291.088 |
| Monoisotopic Mass | 290.97563 |
| SMILES | N[C@@H](Cc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C9H10INO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | PZNQZSRPDOEBMS-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-iodo-L-phenylalanine (CHEBI:44964) is a 4-iodophenylalanine (CHEBI:145892) |
| 4-iodo-L-phenylalanine (CHEBI:44964) is enantiomer of 4-iodo-D-phenylalanine (CHEBI:43422) |
| Incoming Relation(s) |
| 4-iodo-DL-phenylalanine (CHEBI:145893) has part 4-iodo-L-phenylalanine (CHEBI:44964) |
| 4-iodo-D-phenylalanine (CHEBI:43422) is enantiomer of 4-iodo-L-phenylalanine (CHEBI:44964) |
| IUPAC Name |
|---|
| 4-iodo-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(4-iodophenyl)propanoic acid | IUPAC |
| 4-iodophenylalanine | DrugBank |
| 4-iodo-L-phenylalanine | PDBeChem |
| p-iodo-L-phenylalanine | ChEBI |
| IODO-PHENYLALANINE | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4411317 | Beilstein |
| Gmelin:937336 | Gmelin |
| CAS:24250-85-9 | ChemIDplus |
| Citations |
|---|