EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44940 - 4-nitrophenyl methylphosphonate
| Formula | C7H7NO5P |
| Net Charge | -1 |
| Average Mass | 216.109 |
| Monoisotopic Mass | 216.00673 |
| SMILES | CP(=O)([O-])Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H8NO5P/c1-14(11,12)13-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,11,12)/p-1 |
| InChIKey | VJPXTXIEAOSJBR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrophenyl methylphosphonate (CHEBI:44940) has role epitope (CHEBI:53000) |
| 4-nitrophenyl methylphosphonate (CHEBI:44940) is a C-nitro compound (CHEBI:35716) |
| 4-nitrophenyl methylphosphonate (CHEBI:44940) is a organophosphonate oxoanion (CHEBI:59635) |
| IUPAC Name |
|---|
| 4-nitrophenyl methylphosphonate |
| Citations |
|---|