EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44939 - p-nitrobenzyl glutaryl glycinic acid
| Formula | C14H17N3O6 |
| Net Charge | 0 |
| Average Mass | 323.305 |
| Monoisotopic Mass | 323.11174 |
| SMILES | O=C(O)CNC(=O)CCCC(=O)NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O6/c18-12(2-1-3-13(19)16-9-14(20)21)15-8-10-4-6-11(7-5-10)17(22)23/h4-7H,1-3,8-9H2,(H,15,18)(H,16,19)(H,20,21) |
| InChIKey | UCFVFUIGNWHAJJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-nitrobenzyl glutaryl glycinic acid (CHEBI:44939) has functional parent glutaric acid (CHEBI:17859) |
| p-nitrobenzyl glutaryl glycinic acid (CHEBI:44939) has role epitope (CHEBI:53000) |
| p-nitrobenzyl glutaryl glycinic acid (CHEBI:44939) is a C-nitro compound (CHEBI:35716) |
| p-nitrobenzyl glutaryl glycinic acid (CHEBI:44939) is a glycine derivative (CHEBI:24373) |
| IUPAC Name |
|---|
| N-{5-[(4-nitrobenzyl)amino]-5-oxopentanoyl}glycine |
| Synonym | Source |
|---|---|
| 2-[[5-[(4-nitrophenyl)methylamino]-5-oxopentanoyl]amino]ethanoic acid | PDB |
| Citations |
|---|