EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N2O8P |
| Net Charge | 0 |
| Average Mass | 346.232 |
| Monoisotopic Mass | 346.05660 |
| SMILES | O=C(O)CNC(=O)CCCP(=O)(O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15N2O8P/c15-11(13-8-12(16)17)2-1-7-23(20,21)22-10-5-3-9(4-6-10)14(18)19/h3-6H,1-2,7-8H2,(H,13,15)(H,16,17)(H,20,21) |
| InChIKey | WLNKGRQBMNPVSJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(p-nitrophenylphosphobutanoyl)glycine (CHEBI:44930) has role epitope (CHEBI:53000) |
| N-(p-nitrophenylphosphobutanoyl)glycine (CHEBI:44930) is a C-nitro compound (CHEBI:35716) |
| N-(p-nitrophenylphosphobutanoyl)glycine (CHEBI:44930) is a N-acylglycine (CHEBI:16180) |
| N-(p-nitrophenylphosphobutanoyl)glycine (CHEBI:44930) is a phosphonic ester (CHEBI:37735) |
| IUPAC Name |
|---|
| N-{4-[hydroxy(4-nitrophenoxy)phosphoryl]butanoyl}glycine |
| Synonyms | Source |
|---|---|
| N-[4-(4-nitrophenylphospho)butanoyl]glycine | ChEBI |
| 4-nitrophenylphosphobutanoyl-glycine | ChEBI |
| Citations |
|---|