EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14NO5P |
| Net Charge | 0 |
| Average Mass | 259.198 |
| Monoisotopic Mass | 259.06096 |
| SMILES | N[C@@H](Cc1ccc(CP(=O)(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C10H14NO5P/c11-9(10(12)13)5-7-1-3-8(4-2-7)6-17(14,15)16/h1-4,9H,5-6,11H2,(H,12,13)(H2,14,15,16)/t9-/m0/s1 |
| InChIKey | SAQLLHDEEMZENJ-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(phosphonomethyl)-L-phenylalanine (CHEBI:44916) is a L-phenylalanine derivative (CHEBI:84144) |
| 4-(phosphonomethyl)-L-phenylalanine (CHEBI:44916) is a 4-(phosphonomethyl)phenylalanine (CHEBI:228212) |
| 4-(phosphonomethyl)-L-phenylalanine (CHEBI:44916) is enantiomer of 4-(phosphonomethyl)-D-phenylalanine (CHEBI:228220) |
| Incoming Relation(s) |
| 4-(phosphonomethyl)-D-phenylalanine (CHEBI:228220) is enantiomer of 4-(phosphonomethyl)-L-phenylalanine (CHEBI:44916) |
| IUPAC Name |
|---|
| 4-(phosphonomethyl)-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-[4-(phosphonomethyl)phenyl]propanoic acid | IUPAC |
| 4-phosphonomethyl-L-phenylalanine | ChEBI |
| p-phosphonomethyl-L-phenylalanine | ChEBI |
| (S)-2-amino-3-(4-(phosphonomethyl)phenyl)propanoic acid | ChEBI |
| (S)-α-amino-p-(phosphonomethyl)benzenepropanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:142434-81-9 | ChEBI |
| Citations |
|---|