EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O |
| Net Charge | 0 |
| Average Mass | 178.275 |
| Monoisotopic Mass | 178.13577 |
| SMILES | CC(C)c1cccc(C(C)C)c1O |
| InChI | InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 |
| InChIKey | OLBCVFGFOZPWHH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. anticonvulsant A drug used to prevent seizures or reduce their severity. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propofol (CHEBI:44915) has role anticonvulsant (CHEBI:35623) |
| propofol (CHEBI:44915) has role antiemetic (CHEBI:50919) |
| propofol (CHEBI:44915) has role intravenous anaesthetic (CHEBI:38877) |
| propofol (CHEBI:44915) has role radical scavenger (CHEBI:48578) |
| propofol (CHEBI:44915) has role sedative (CHEBI:35717) |
| propofol (CHEBI:44915) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 4-hydroxypropofol (CHEBI:145211) has functional parent propofol (CHEBI:44915) |
| IUPAC Name |
|---|
| 2,6-bis(propan-2-yl)phenol |
| INN | Source |
|---|---|
| propofol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 2,6-bis(1-methylethyl)phenol | ChemIDplus |
| 2,6-BIS(1-METHYLETHYL)PHENOL | PDBeChem |
| 2,6-Diisopropylphenol | KEGG COMPOUND |
| Disoprofol | ChemIDplus |
| Propofol | KEGG COMPOUND |
| propofolum | ChemIDplus |
| Brand Names | Source |
|---|---|
| Diprivan | KEGG DRUG |
| Disoprivan | DrugBank |
| Disoprofol | DrugBank |
| Rapinovet | DrugBank |