EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O2 |
| Net Charge | 0 |
| Average Mass | 76.095 |
| Monoisotopic Mass | 76.05243 |
| SMILES | C[C@@H](O)CO |
| InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/t3-/m1/s1 |
| InChIKey | DNIAPMSPPWPWGF-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-propane-1,2-diol (CHEBI:28972) has role Escherichia coli metabolite (CHEBI:76971) |
| (R)-propane-1,2-diol (CHEBI:28972) has role human metabolite (CHEBI:77746) |
| (R)-propane-1,2-diol (CHEBI:28972) is a propane-1,2-diol (CHEBI:16997) |
| (R)-propane-1,2-diol (CHEBI:28972) is enantiomer of (S)-propane-1,2-diol (CHEBI:29002) |
| Incoming Relation(s) |
| (S)-propane-1,2-diol (CHEBI:29002) is enantiomer of (R)-propane-1,2-diol (CHEBI:28972) |
| IUPAC Name |
|---|
| (2R)-propane-1,2-diol |
| Synonyms | Source |
|---|---|
| (R)-1,2-Propanediol | KEGG COMPOUND |
| R-1,2-PROPANEDIOL | PDBeChem |
| (R)-propane-1,2-diol | ChEBI |
| (R)-Propane-1,2-diol | KEGG COMPOUND |
| (R)-Propylene glycol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (R)-propane-1,2-diol | UniProt |