EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO2 |
| Net Charge | 0 |
| Average Mass | 153.181 |
| Monoisotopic Mass | 153.07898 |
| SMILES | NC[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO2/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,8,10-11H,5,9H2/t8-/m1/s1 |
| InChIKey | QHGUCRYDKWKLMG-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-octopamine (CHEBI:44808) is a octopamine (CHEBI:17134) |
| (S)-octopamine (CHEBI:44808) is enantiomer of (R)-octopamine (CHEBI:44715) |
| Incoming Relation(s) |
| (R)-octopamine (CHEBI:44715) is enantiomer of (S)-octopamine (CHEBI:44808) |
| IUPAC Name |
|---|
| 4-[(1S)-2-amino-1-hydroxyethyl]phenol |
| Synonym | Source |
|---|---|
| 4-(2S-AMINO-1-HYDROXYETHYL)PHENOL | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| OTS | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2831147 | Beilstein |