EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44800 - (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | C[C@@]1(O)OC[C@H](O)C1(O)O |
| InChI | InChI=1S/C5H10O5/c1-4(7)5(8,9)3(6)2-10-4/h3,6-9H,2H2,1H3/t3-,4+/m0/s1 |
| InChIKey | BVIYGXUQVXBHQS-IUYQGCFVSA-N |
| Roles Classification |
|---|
| Biological Role: | autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) has role autoinducer (CHEBI:71338) |
| (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a cyclic ketal (CHEBI:59779) |
| (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a ketone hydrate (CHEBI:63734) |
| (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a tetrahydroxytetrahydrofuran (CHEBI:47041) |
| (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol |
| Synonyms | Source |
|---|---|
| (2R,4S)-2-methyldihydrofuran-2,3,3,4(2H)-tetrol | IUPAC |
| (2R,4S)-2-methyloxolane-2,3,3,4-tetrol | ChEBI |
| (2R,4S)-2-METHYL-2,3,3,4-TETRAHYDROXYTETRAHYDROFURAN | PDBeChem |
| AI-2 | MetaCyc |
| auto inducer 2 | MetaCyc |
| (R)-THMF | MetaCyc |
| UniProt Name | Source |
|---|---|
| (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol | UniProt |
| Citations |
|---|