EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2 |
| Net Charge | 0 |
| Average Mass | 101.105 |
| Monoisotopic Mass | 101.04768 |
| SMILES | CC(=O)C(C)=NO |
| InChI | InChI=1S/C4H7NO2/c1-3(5-7)4(2)6/h7H,1-2H3 |
| InChIKey | FSEUPUDHEBLWJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.6.1.3 (adenosinetriphosphatase) inhibitor An EC 3.6.1.* (hydrolases acting on acid anhydrides in P-containing anhydrides) inhibitor that interferes with the action of adenosinetriphosphatase (EC 3.6.1.3). cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diacetylmonoxime (CHEBI:4480) has role cholinesterase reactivator (CHEBI:50241) |
| diacetylmonoxime (CHEBI:4480) has role chromogenic compound (CHEBI:75050) |
| diacetylmonoxime (CHEBI:4480) has role EC 3.6.1.3 (adenosinetriphosphatase) inhibitor (CHEBI:78928) |
| diacetylmonoxime (CHEBI:4480) is a ketoxime (CHEBI:24983) |
| IUPAC Name |
|---|
| 3-(hydroxyimino)butan-2-one |
| Synonyms | Source |
|---|---|
| 2,3-butadione monooxime | ChEBI |
| 2,3-butanedione-2-monoxime | ChemIDplus |
| 2,3-butanedione 3-monoxime | ChemIDplus |
| 2,3-butanedione monoxime | ChemIDplus |
| 2,3-butanedione oxime | ChemIDplus |
| 2-hydroxyimino-3-butanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4911363 | ChemSpider |
| C07509 | KEGG COMPOUND |
| Diacetyl_monoxime | Wikipedia |
| HMDB0245382 | HMDB |
| Citations |
|---|