EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O5 |
| Net Charge | 0 |
| Average Mass | 222.196 |
| Monoisotopic Mass | 222.05282 |
| SMILES | O=C(O)CCC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H10O5/c12-9(5-6-10(13)14)7-3-1-2-4-8(7)11(15)16/h1-4H,5-6H2,(H,13,14)(H,15,16) |
| InChIKey | YIVWQNVQRXFZJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-succinylbenzoic acid (CHEBI:44788) has functional parent benzoic acid (CHEBI:30746) |
| 2-succinylbenzoic acid (CHEBI:44788) is a dicarboxylic acid (CHEBI:35692) |
| 2-succinylbenzoic acid (CHEBI:44788) is conjugate acid of 2-succinatobenzoate (CHEBI:18325) |
| Incoming Relation(s) |
| 4-(2-carboxyphenyl)-4-oxobutanoyl-CoA (CHEBI:15509) has functional parent 2-succinylbenzoic acid (CHEBI:44788) |
| 2-succinatobenzoate (CHEBI:18325) is conjugate base of 2-succinylbenzoic acid (CHEBI:44788) |
| IUPAC Name |
|---|
| 2-(3-carboxypropanoyl)benzoic acid |
| Synonyms | Source |
|---|---|
| o-succinylbenzoic acid | ChemIDplus |
| 4-(2'-carboxyphenyl)-4-oxobutyric acid | ChemIDplus |
| 2-(3-carboxypropionyl)benzoic acid | ChEBI |
| 2-SUCCINYLBENZOATE | PDBeChem |
| o-Succinylbenzoate | KEGG COMPOUND |
| Succinylbenzoate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2696599 | Beilstein |
| CAS:27415-09-4 | ChemIDplus |