EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO |
| Net Charge | 0 |
| Average Mass | 245.366 |
| Monoisotopic Mass | 245.17796 |
| SMILES | [H][C@]12CCCCC[C@](C)(c3cc(O)ccc3C1)[C@H]2N |
| InChI | InChI=1S/C16H23NO/c1-16-8-4-2-3-5-12(15(16)17)9-11-6-7-13(18)10-14(11)16/h6-7,10,12,15,18H,2-5,8-9,17H2,1H3/t12-,15-,16+/m0/s1 |
| InChIKey | VTMVHDZWSFQSQP-VBNZEHGJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dezocine (CHEBI:4474) has role opioid analgesic (CHEBI:35482) |
| dezocine (CHEBI:4474) is a phenols (CHEBI:33853) |
| dezocine (CHEBI:4474) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (5R,11S,13S)-13-amino-5-methyl-5,6,7,8,9,10,11,12-octahydro-5,11-methanobenzocyclodecen-3-ol |
| INNs | Source |
|---|---|
| dezocine | ChemIDplus |
| dezocina | ChemIDplus |
| dezocinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Dezocine | KEGG COMPOUND |
| (−)-13β-amino-5,6,7,8,9,10,11α,12-octahydro-5α-methyl-5,11-methanobenzocyclodecen-3-ol | ChemIDplus |