EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5N3O4 |
| Net Charge | 0 |
| Average Mass | 159.101 |
| Monoisotopic Mass | 159.02801 |
| SMILES | O=C1NC(=O)NC(C(=O)O)N1 |
| InChI | InChI=1S/C4H5N3O4/c8-2(9)1-5-3(10)7-4(11)6-1/h1H,(H,8,9)(H3,5,6,7,10,11) |
| InChIKey | IRFZLMWJJPULRF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydro-5-azaorotic acid (CHEBI:44725) is a 1,3,5-triazinanes (CHEBI:38779) |
| dihydro-5-azaorotic acid (CHEBI:44725) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 4,6-dioxo-1,3,5-triazinane-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-aza-5,6-dihydroorotic acid | ChemIDplus |
| dihydro-5-azaorotic acid | ChemIDplus |
| hexahydro-4,6-dioxo-1,3,5-triazine-2-carboxylic acid | ChemIDplus |