EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O3 |
| Net Charge | 0 |
| Average Mass | 158.197 |
| Monoisotopic Mass | 158.09429 |
| SMILES | CCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C8H14O3/c1-2-3-4-5-7(9)6-8(10)11/h2-6H2,1H3,(H,10,11) |
| InChIKey | FWNRRWJFOZIGQZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxooctanoic acid (CHEBI:44680) has functional parent octanoic acid (CHEBI:28837) |
| 3-oxooctanoic acid (CHEBI:44680) is a 3-oxo fatty acid (CHEBI:134416) |
| Incoming Relation(s) |
| 3-oxooctanoyl-CoA (CHEBI:28264) has functional parent 3-oxooctanoic acid (CHEBI:44680) |
| IUPAC Name |
|---|
| 3-oxooctanoic acid |
| Synonyms | Source |
|---|---|
| 3-Ketooctanoic acid | ChemIDplus |
| 3-keto-n-caprylic acid | LIPID MAPS |
| β-ketocaprylic acid | ChEBI |
| β-ketooctanoic acid | ChEBI |
| β-oxocaprylic acid | ChEBI |
| β-oxooctanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060017 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1761409 | Beilstein |
| CAS:13283-91-5 | ChemIDplus |
| Citations |
|---|